C12H13NO3 — CID 34957180
(2S)-3-(3,4-dimethoxyphenyl)-2-methyl-3-oxopropanenitrile (PubChem CID 34957180) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-3-oxopropanenitrile.
| Compound Name | (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-3-oxopropanenitrile |
|---|---|
| PubChem CID | 34957180 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-3-oxopropanenitrile |
| SMILES | COc1ccc(C(=O)[C@@H](C)C#N)cc1OC |
| InChI | InChI=1S/C12H13NO3/c1-8(7-13)12(14)9-4-5-10(15-2)11(6-9)16-3/h4-6,8H,1-3H3/t8-/m0/s1 |
| InChIKey | WFGOEPGQMAGOCW-QMMMGPOBSA-N |
| XLogP | 2.05 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|