C16H19NO4 — CID 840757
propan-2-yl (E)-2-cyano-3-(3,4-dimethoxyphenyl)but-2-enoate (PubChem CID 840757) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is propan-2-yl (E)-2-cyano-3-(3,4-dimethoxyphenyl)but-2-enoate.
| Compound Name | propan-2-yl (E)-2-cyano-3-(3,4-dimethoxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 840757 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | propan-2-yl (E)-2-cyano-3-(3,4-dimethoxyphenyl)but-2-enoate |
| SMILES | COc1ccc(/C(C)=C(\C#N)C(=O)OC(C)C)cc1OC |
| InChI | InChI=1S/C16H19NO4/c1-10(2)21-16(18)13(9-17)11(3)12-6-7-14(19-4)15(8-12)20-5/h6-8,10H,1-5H3/b13-11+ |
| InChIKey | YXPDFLOVZKUUFW-ACCUITESSA-N |
| XLogP | 2.95 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|