C14H16N2O5 — CID 18206879
1-cyanoethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 18206879) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-cyanoethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate.
| Compound Name | 1-cyanoethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 18206879 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-cyanoethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OC(C)C#N)cc1OC |
| InChI | InChI=1S/C14H16N2O5/c1-9(7-15)21-13(17)8-16-14(18)10-4-5-11(19-2)12(6-10)20-3/h4-6,9H,8H2,1-3H3,(H,16,18) |
| InChIKey | DZMINUOVNGARSQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |