C13H14Br2O4 — CID 113438044
3-bromo-4-(3-bromo-4-propoxyphenyl)-4-oxobutanoic acid (PubChem CID 113438044) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is 3-bromo-4-(3-bromo-4-propoxyphenyl)-4-oxobutanoic acid.
| Compound Name | 3-bromo-4-(3-bromo-4-propoxyphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 113438044 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 3-bromo-4-(3-bromo-4-propoxyphenyl)-4-oxobutanoic acid |
| SMILES | CCCOc1ccc(C(=O)C(Br)CC(=O)O)cc1Br |
| InChI | InChI=1S/C13H14Br2O4/c1-2-5-19-11-4-3-8(6-9(11)14)13(18)10(15)7-12(16)17/h3-4,6,10H,2,5,7H2,1H3,(H,16,17) |
| InChIKey | CQTBCCMHQVSPRH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|