C16H13BrCl2O2 — CID 104656961
(3-bromo-4-propoxyphenyl)-(3,5-dichlorophenyl)methanone (PubChem CID 104656961) has the molecular formula C16H13BrCl2O2 and a molecular weight of 388.09 g/mol. Its IUPAC name is (3-bromo-4-propoxyphenyl)-(3,5-dichlorophenyl)methanone.
| Compound Name | (3-bromo-4-propoxyphenyl)-(3,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 104656961 |
| Molecular Formula | C16H13BrCl2O2 |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | (3-bromo-4-propoxyphenyl)-(3,5-dichlorophenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)c2cc(Cl)cc(Cl)c2)cc1Br |
| InChI | InChI=1S/C16H13BrCl2O2/c1-2-5-21-15-4-3-10(8-14(15)17)16(20)11-6-12(18)9-13(19)7-11/h3-4,6-9H,2,5H2,1H3 |
| InChIKey | DHACWLCPODMUKZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |