C19H29NO4 — CID 7126466
(2S,3R)-2-[[3-(4-butoxyphenyl)-3-oxopropyl]amino]-3-methylpentanoic acid (PubChem CID 7126466) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (2S,3R)-2-[[3-(4-butoxyphenyl)-3-oxopropyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[[3-(4-butoxyphenyl)-3-oxopropyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 7126466 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (2S,3R)-2-[[3-(4-butoxyphenyl)-3-oxopropyl]amino]-3-methylpentanoic acid |
| SMILES | CCCCOc1ccc(C(=O)CCN[C@H](C(=O)O)[C@H](C)CC)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-4-6-13-24-16-9-7-15(8-10-16)17(21)11-12-20-18(19(22)23)14(3)5-2/h7-10,14,18,20H,4-6,11-13H2,1-3H3,(H,22,23)/t14-,18+/m1/s1 |
| InChIKey | LWUHBOOSZNTMQV-KDOFPFPSSA-N |
| XLogP | 3.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|