C23H32N2O6S — CID 46421231
N-[1-(3,4-dipropoxyphenyl)ethyl]-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 46421231) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is N-[1-(3,4-dipropoxyphenyl)ethyl]-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-[1-(3,4-dipropoxyphenyl)ethyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 46421231 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[1-(3,4-dipropoxyphenyl)ethyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)c2cccc(S(=O)(=O)N(C)OC)c2)cc1OCCC |
| InChI | InChI=1S/C23H32N2O6S/c1-6-13-30-21-12-11-18(16-22(21)31-14-7-2)17(3)24-23(26)19-9-8-10-20(15-19)32(27,28)25(4)29-5/h8-12,15-17H,6-7,13-14H2,1-5H3,(H,24,26) |
| InChIKey | AEUDWQXYDUNWRT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|