C10H13BrN2O3 — CID 43630226
2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]pentanoic acid (PubChem CID 43630226) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43630226 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1cc(Br)c[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13BrN2O3/c1-2-3-7(10(15)16)13-9(14)8-4-6(11)5-12-8/h4-5,7,12H,2-3H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | OSIXUNHWNZSHTJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |