C14H14Br2N2O3 — CID 43630529
2-[(5,6-dibromo-1H-indole-3-carbonyl)amino]pentanoic acid (PubChem CID 43630529) has the molecular formula C14H14Br2N2O3 and a molecular weight of 418.09 g/mol. Its IUPAC name is 2-[(5,6-dibromo-1H-indole-3-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[(5,6-dibromo-1H-indole-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43630529 |
| Molecular Formula | C14H14Br2N2O3 |
| Molecular Weight | 418.09 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 2-[(5,6-dibromo-1H-indole-3-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1c[nH]c2cc(Br)c(Br)cc12)C(=O)O |
| InChI | InChI=1S/C14H14Br2N2O3/c1-2-3-11(14(20)21)18-13(19)8-6-17-12-5-10(16)9(15)4-7(8)12/h4-6,11,17H,2-3H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | PNEYDZLWJWXPLY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.09 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |