C12H13BrFNO3 — CID 43630288
2-[(2-bromo-4-fluorobenzoyl)amino]pentanoic acid (PubChem CID 43630288) has the molecular formula C12H13BrFNO3 and a molecular weight of 318.14 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorobenzoyl)amino]pentanoic acid.
| Compound Name | 2-[(2-bromo-4-fluorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43630288 |
| Molecular Formula | C12H13BrFNO3 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-[(2-bromo-4-fluorobenzoyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1ccc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H13BrFNO3/c1-2-3-10(12(17)18)15-11(16)8-5-4-7(14)6-9(8)13/h4-6,10H,2-3H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | FHUVKRMBBUOEKX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |