C12H13F2NO3 — CID 107564266
(2S)-2-[(2,4-difluorobenzoyl)amino]pentanoic acid (PubChem CID 107564266) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2S)-2-[(2,4-difluorobenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[(2,4-difluorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107564266 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2S)-2-[(2,4-difluorobenzoyl)amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C12H13F2NO3/c1-2-3-10(12(17)18)15-11(16)8-5-4-7(13)6-9(8)14/h4-6,10H,2-3H2,1H3,(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | LGMNLCPTPLPACO-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |