C15H18Br2N2O2 — CID 103852404
5,6-dibromo-N-(1-hydroxy-4-methylpentan-3-yl)-1H-indole-3-carboxamide (PubChem CID 103852404) has the molecular formula C15H18Br2N2O2 and a molecular weight of 418.13 g/mol. Its IUPAC name is 5,6-dibromo-N-(1-hydroxy-4-methylpentan-3-yl)-1H-indole-3-carboxamide.
| Compound Name | 5,6-dibromo-N-(1-hydroxy-4-methylpentan-3-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 103852404 |
| Molecular Formula | C15H18Br2N2O2 |
| Molecular Weight | 418.13 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 5,6-dibromo-N-(1-hydroxy-4-methylpentan-3-yl)-1H-indole-3-carboxamide |
| SMILES | CC(C)C(CCO)NC(=O)c1c[nH]c2cc(Br)c(Br)cc12 |
| InChI | InChI=1S/C15H18Br2N2O2/c1-8(2)13(3-4-20)19-15(21)10-7-18-14-6-12(17)11(16)5-9(10)14/h5-8,13,18,20H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | PLRMQJJZWQKPLZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.13 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |