C14H16Br2N2O2 — CID 79252342
5,6-dibromo-N-(1-hydroxy-3-methylbutan-2-yl)-1H-indole-3-carboxamide (PubChem CID 79252342) has the molecular formula C14H16Br2N2O2 and a molecular weight of 404.10 g/mol. Its IUPAC name is 5,6-dibromo-N-(1-hydroxy-3-methylbutan-2-yl)-1H-indole-3-carboxamide.
| Compound Name | 5,6-dibromo-N-(1-hydroxy-3-methylbutan-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 79252342 |
| Molecular Formula | C14H16Br2N2O2 |
| Molecular Weight | 404.10 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 5,6-dibromo-N-(1-hydroxy-3-methylbutan-2-yl)-1H-indole-3-carboxamide |
| SMILES | CC(C)C(CO)NC(=O)c1c[nH]c2cc(Br)c(Br)cc12 |
| InChI | InChI=1S/C14H16Br2N2O2/c1-7(2)13(6-19)18-14(20)9-5-17-12-4-11(16)10(15)3-8(9)12/h3-5,7,13,17,19H,6H2,1-2H3,(H,18,20) |
| InChIKey | JOOAOYYDRDEYTP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |