C8H12BrN3O — CID 61249115
N-(3-aminopropyl)-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 61249115) has the molecular formula C8H12BrN3O and a molecular weight of 246.11 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-(3-aminopropyl)-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61249115 |
| Molecular Formula | C8H12BrN3O |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | N-(3-aminopropyl)-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | NCCCNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C8H12BrN3O/c9-6-4-7(12-5-6)8(13)11-3-1-2-10/h4-5,12H,1-3,10H2,(H,11,13) |
| InChIKey | VZSRUJBSUFNGOZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|