C9H12BrN3O2 — CID 47191038
N-(4-amino-4-oxobutyl)-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 47191038) has the molecular formula C9H12BrN3O2 and a molecular weight of 274.12 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 47191038 |
| Molecular Formula | C9H12BrN3O2 |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)CCCNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C9H12BrN3O2/c10-6-4-7(13-5-6)9(15)12-3-1-2-8(11)14/h4-5,13H,1-3H2,(H2,11,14)(H,12,15) |
| InChIKey | WJJGJHBDOYNVLW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|