C10H16BrN3O — CID 43601766
4-bromo-N-[3-(ethylamino)propyl]-1H-pyrrole-2-carboxamide (PubChem CID 43601766) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is 4-bromo-N-[3-(ethylamino)propyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[3-(ethylamino)propyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43601766 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-bromo-N-[3-(ethylamino)propyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCNCCCNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H16BrN3O/c1-2-12-4-3-5-13-10(15)9-6-8(11)7-14-9/h6-7,12,14H,2-5H2,1H3,(H,13,15) |
| InChIKey | RPEXLBDIXRYJCQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|