C11H17BrN2O2 — CID 115589400
4-bromo-N-[2-(2-methylpropoxy)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 115589400) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-methylpropoxy)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(2-methylpropoxy)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115589400 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-bromo-N-[2-(2-methylpropoxy)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)COCCNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C11H17BrN2O2/c1-8(2)7-16-4-3-13-11(15)10-5-9(12)6-14-10/h5-6,8,14H,3-4,7H2,1-2H3,(H,13,15) |
| InChIKey | OPLXUEUHDXJJFP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|