C18H15BrN4O5 — CID 55615537
N-[3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 55615537) has the molecular formula C18H15BrN4O5 and a molecular weight of 447.25 g/mol. Its IUPAC name is N-[3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55615537 |
| Molecular Formula | C18H15BrN4O5 |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | N-[3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccco2)c1)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C18H15BrN4O5/c19-11-7-14(20-9-11)17(25)23-22-16(24)10-28-13-4-1-3-12(8-13)21-18(26)15-5-2-6-27-15/h1-9,20H,10H2,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | XUKPLIGUMUFRIX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|