C23H19N3O6 — CID 55616552
N-[3-[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 55616552) has the molecular formula C23H19N3O6 and a molecular weight of 433.42 g/mol. Its IUPAC name is N-[3-[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55616552 |
| Molecular Formula | C23H19N3O6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[3-[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | Cc1c(C(=O)NNC(=O)COc2cccc(NC(=O)c3ccco3)c2)oc2ccccc12 |
| InChI | InChI=1S/C23H19N3O6/c1-14-17-8-2-3-9-18(17)32-21(14)23(29)26-25-20(27)13-31-16-7-4-6-15(12-16)24-22(28)19-10-5-11-30-19/h2-12H,13H2,1H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | CLNDJSXHQIPGOI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|