C14H13BrN4O4 — CID 55874192
3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]benzamide (PubChem CID 55874192) has the molecular formula C14H13BrN4O4 and a molecular weight of 381.19 g/mol. Its IUPAC name is 3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]benzamide.
| Compound Name | 3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55874192 |
| Molecular Formula | C14H13BrN4O4 |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 3-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCC(=O)NNC(=O)c2cc(Br)c[nH]2)c1 |
| InChI | InChI=1S/C14H13BrN4O4/c15-9-5-11(17-6-9)14(22)19-18-12(20)7-23-10-3-1-2-8(4-10)13(16)21/h1-6,17H,7H2,(H2,16,21)(H,18,20)(H,19,22) |
| InChIKey | HLEPBALWSPRNGH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|