C15H11NO2S2 — CID 63744676
2-(1-benzothiophen-3-ylmethylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 63744676) has the molecular formula C15H11NO2S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylmethylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(1-benzothiophen-3-ylmethylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63744676 |
| Molecular Formula | C15H11NO2S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-(1-benzothiophen-3-ylmethylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCc1csc2ccccc12 |
| InChI | InChI=1S/C15H11NO2S2/c17-15(18)12-5-3-7-16-14(12)20-9-10-8-19-13-6-2-1-4-11(10)13/h1-8H,9H2,(H,17,18) |
| InChIKey | SJWURIFHNHGJCO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |