C13H9BrFNO2S — CID 43385187
2-[(4-bromo-2-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 43385187) has the molecular formula C13H9BrFNO2S and a molecular weight of 342.19 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 43385187 |
| Molecular Formula | C13H9BrFNO2S |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H9BrFNO2S/c14-9-4-3-8(11(15)6-9)7-19-12-10(13(17)18)2-1-5-16-12/h1-6H,7H2,(H,17,18) |
| InChIKey | UGOPVZKGNRWJOJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |