C24H21F2N3O3S — CID 55546321
[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone (PubChem CID 55546321) has the molecular formula C24H21F2N3O3S and a molecular weight of 469.51 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone.
| Compound Name | [4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 55546321 |
| Molecular Formula | C24H21F2N3O3S |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCN(C(=O)c2cccnc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C24H21F2N3O3S/c25-24(26)32-20-11-5-4-9-18(20)22(30)28-13-15-29(16-14-28)23(31)19-10-6-12-27-21(19)33-17-7-2-1-3-8-17/h1-12,24H,13-16H2 |
| InChIKey | KTUURUCOIOEARM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |