C17H13F6N3O2 — CID 133371027
[2-(difluoromethoxy)phenyl]-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone (PubChem CID 133371027) has the molecular formula C17H13F6N3O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 133371027 |
| Molecular Formula | C17H13F6N3O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C17H13F6N3O2/c18-11-13(12(19)15(21)24-14(11)20)25-5-7-26(8-6-25)16(27)9-3-1-2-4-10(9)28-17(22)23/h1-4,17H,5-8H2 |
| InChIKey | PIALBOAUBDOTEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|