C19H23N3O3S2 — CID 56533625
[4-(2-methylsulfonylethyl)piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone (PubChem CID 56533625) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is [4-(2-methylsulfonylethyl)piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone.
| Compound Name | [4-(2-methylsulfonylethyl)piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 56533625 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [4-(2-methylsulfonylethyl)piperazin-1-yl]-(2-phenylsulfanyl-3-pyridinyl)methanone |
| SMILES | CS(=O)(=O)CCN1CCN(C(=O)c2cccnc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N3O3S2/c1-27(24,25)15-14-21-10-12-22(13-11-21)19(23)17-8-5-9-20-18(17)26-16-6-3-2-4-7-16/h2-9H,10-15H2,1H3 |
| InChIKey | XMCJAHFUMWEVCV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |