C14H19NO4 — CID 14097634
diethyl 5-propylpyridine-2,3-dicarboxylate (PubChem CID 14097634) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is diethyl 5-propylpyridine-2,3-dicarboxylate.
| Compound Name | diethyl 5-propylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 14097634 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | diethyl 5-propylpyridine-2,3-dicarboxylate |
| SMILES | CCCc1cnc(C(=O)OCC)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C14H19NO4/c1-4-7-10-8-11(13(16)18-5-2)12(15-9-10)14(17)19-6-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | HXIKIUMJSDTHDB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |