C10H12N2O4 — CID 13000769
diethyl pyrimidine-4,5-dicarboxylate (PubChem CID 13000769) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is diethyl pyrimidine-4,5-dicarboxylate.
| Compound Name | diethyl pyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 13000769 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | diethyl pyrimidine-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1cncnc1C(=O)OCC |
| InChI | InChI=1S/C10H12N2O4/c1-3-15-9(13)7-5-11-6-12-8(7)10(14)16-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | SSEHRLNTVKILCW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |