C9H12N2O3S — CID 121455219
2-(2-aminoethylsulfanyl)-5-methoxypyridine-3-carboxylic acid (PubChem CID 121455219) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-5-methoxypyridine-3-carboxylic acid.
| Compound Name | 2-(2-aminoethylsulfanyl)-5-methoxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 121455219 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-5-methoxypyridine-3-carboxylic acid |
| SMILES | COc1cnc(SCCN)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H12N2O3S/c1-14-6-4-7(9(12)13)8(11-5-6)15-3-2-10/h4-5H,2-3,10H2,1H3,(H,12,13) |
| InChIKey | DOPNJSZTEHRJPV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |