C14H13NO4S — CID 106767781
1-(3-methoxy-3-oxopropyl)sulfanylisoquinoline-4-carboxylic acid (PubChem CID 106767781) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-(3-methoxy-3-oxopropyl)sulfanylisoquinoline-4-carboxylic acid.
| Compound Name | 1-(3-methoxy-3-oxopropyl)sulfanylisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 106767781 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(3-methoxy-3-oxopropyl)sulfanylisoquinoline-4-carboxylic acid |
| SMILES | COC(=O)CCSc1ncc(C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C14H13NO4S/c1-19-12(16)6-7-20-13-10-5-3-2-4-9(10)11(8-15-13)14(17)18/h2-5,8H,6-7H2,1H3,(H,17,18) |
| InChIKey | PJJPTVIUQQJNIG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |