C10H11NO4S — CID 105062859
3-(3-methoxy-3-oxopropyl)sulfanylpyridine-4-carboxylic acid (PubChem CID 105062859) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-(3-methoxy-3-oxopropyl)sulfanylpyridine-4-carboxylic acid.
| Compound Name | 3-(3-methoxy-3-oxopropyl)sulfanylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105062859 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 3-(3-methoxy-3-oxopropyl)sulfanylpyridine-4-carboxylic acid |
| SMILES | COC(=O)CCSc1cnccc1C(=O)O |
| InChI | InChI=1S/C10H11NO4S/c1-15-9(12)3-5-16-8-6-11-4-2-7(8)10(13)14/h2,4,6H,3,5H2,1H3,(H,13,14) |
| InChIKey | FCHMOKQTVGEEFC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |