C14H23ClN2O5 — CID 159213008
5-chloro-2-(3-ethoxypropylamino)pyridine-3-carboxylic acid;propane-1,2-diol (PubChem CID 159213008) has the molecular formula C14H23ClN2O5 and a molecular weight of 334.80 g/mol. Its IUPAC name is 5-chloro-2-(3-ethoxypropylamino)pyridine-3-carboxylic acid;propane-1,2-diol.
| Compound Name | 5-chloro-2-(3-ethoxypropylamino)pyridine-3-carboxylic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 159213008 |
| Molecular Formula | C14H23ClN2O5 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-chloro-2-(3-ethoxypropylamino)pyridine-3-carboxylic acid;propane-1,2-diol |
| SMILES | CC(O)CO.CCOCCCNc1ncc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H15ClN2O3.C3H8O2/c1-2-17-5-3-4-13-10-9(11(15)16)6-8(12)7-14-10;1-3(5)2-4/h6-7H,2-5H2,1H3,(H,13,14)(H,15,16);3-5H,2H2,1H3 |
| InChIKey | KQSRBUAABPOHQD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|