C10H14F2N2O2 — CID 106306945
2-[3-[(3,5-difluoro-2-pyridinyl)amino]propoxy]ethanol (PubChem CID 106306945) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-[3-[(3,5-difluoro-2-pyridinyl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(3,5-difluoro-2-pyridinyl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106306945 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-[3-[(3,5-difluoro-2-pyridinyl)amino]propoxy]ethanol |
| SMILES | OCCOCCCNc1ncc(F)cc1F |
| InChI | InChI=1S/C10H14F2N2O2/c11-8-6-9(12)10(14-7-8)13-2-1-4-16-5-3-15/h6-7,15H,1-5H2,(H,13,14) |
| InChIKey | MDGZTQSGBYGEGG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|