C12H16F3NO2 — CID 103992547
2-[3-[(2,4,5-trifluorophenyl)methylamino]propoxy]ethanol (PubChem CID 103992547) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[3-[(2,4,5-trifluorophenyl)methylamino]propoxy]ethanol.
| Compound Name | 2-[3-[(2,4,5-trifluorophenyl)methylamino]propoxy]ethanol |
|---|---|
| PubChem CID | 103992547 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[3-[(2,4,5-trifluorophenyl)methylamino]propoxy]ethanol |
| SMILES | OCCOCCCNCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H16F3NO2/c13-10-7-12(15)11(14)6-9(10)8-16-2-1-4-18-5-3-17/h6-7,16-17H,1-5,8H2 |
| InChIKey | GRNDUJVJQDJGHC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|