C16H16F3NO — CID 103792435
3-phenoxy-N-[(2,4,5-trifluorophenyl)methyl]propan-1-amine (PubChem CID 103792435) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-phenoxy-N-[(2,4,5-trifluorophenyl)methyl]propan-1-amine.
| Compound Name | 3-phenoxy-N-[(2,4,5-trifluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103792435 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-phenoxy-N-[(2,4,5-trifluorophenyl)methyl]propan-1-amine |
| SMILES | Fc1cc(F)c(CNCCCOc2ccccc2)cc1F |
| InChI | InChI=1S/C16H16F3NO/c17-14-10-16(19)15(18)9-12(14)11-20-7-4-8-21-13-5-2-1-3-6-13/h1-3,5-6,9-10,20H,4,7-8,11H2 |
| InChIKey | VHTRDRRFKXSNKT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|