C8H8F4N2 — CID 127013338
N-(3,3-difluoropropyl)-3,5-difluoropyridin-2-amine (PubChem CID 127013338) has the molecular formula C8H8F4N2 and a molecular weight of 208.16 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)-3,5-difluoropyridin-2-amine.
| Compound Name | N-(3,3-difluoropropyl)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 127013338 |
| Molecular Formula | C8H8F4N2 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | N-(3,3-difluoropropyl)-3,5-difluoropyridin-2-amine |
| SMILES | Fc1cnc(NCCC(F)F)c(F)c1 |
| InChI | InChI=1S/C8H8F4N2/c9-5-3-6(10)8(14-4-5)13-2-1-7(11)12/h3-4,7H,1-2H2,(H,13,14) |
| InChIKey | AJOLHNJEJIFGBU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |