C22H26Cl2N4O — CID 69072865
N',N'-dimethyl-N-[2-(5-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride (PubChem CID 69072865) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(5-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dimethyl-N-[2-(5-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 69072865 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N',N'-dimethyl-N-[2-(5-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride |
| SMILES | Cc1ccc2oc(-c3nc(NCCCN(C)C)c4ccccc4n3)cc2c1.Cl.Cl |
| InChI | InChI=1S/C22H24N4O.2ClH/c1-15-9-10-19-16(13-15)14-20(27-19)22-24-18-8-5-4-7-17(18)21(25-22)23-11-6-12-26(2)3;;/h4-5,7-10,13-14H,6,11-12H2,1-3H3,(H,23,24,25);2*1H |
| InChIKey | SLMBUJHZYQVSNC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|