C23H26N4O — CID 24871938
N',N'-dimethyl-N-[8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine (PubChem CID 24871938) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is N',N'-dimethyl-N-[8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 24871938 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N',N'-dimethyl-N-[8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinazolin-4-yl]propane-1,3-diamine |
| SMILES | Cc1c(-c2nc(NCCCN(C)C)c3cccc(C)c3n2)oc2ccccc12 |
| InChI | InChI=1S/C23H26N4O/c1-15-9-7-11-18-20(15)25-23(26-22(18)24-13-8-14-27(3)4)21-16(2)17-10-5-6-12-19(17)28-21/h5-7,9-12H,8,13-14H2,1-4H3,(H,24,25,26) |
| InChIKey | LJYMDIDFUGJVRO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|