C28H29ClN6 — CID 121402759
N-[2-(1-benzyl-7-chloroindazol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402759) has the molecular formula C28H29ClN6 and a molecular weight of 485.04 g/mol. Its IUPAC name is N-[2-(1-benzyl-7-chloroindazol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(1-benzyl-7-chloroindazol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402759 |
| Molecular Formula | C28H29ClN6 |
| Molecular Weight | 485.04 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[2-(1-benzyl-7-chloroindazol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cccc2c(NCCCN(C)C)nc(-c3nn(Cc4ccccc4)c4c(Cl)cccc34)nc12 |
| InChI | InChI=1S/C28H29ClN6/c1-19-10-7-14-22-24(19)31-28(32-27(22)30-16-9-17-34(2)3)25-21-13-8-15-23(29)26(21)35(33-25)18-20-11-5-4-6-12-20/h4-8,10-15H,9,16-18H2,1-3H3,(H,30,31,32) |
| InChIKey | VTSUELCSYNRGQC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.04 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|