C28H27Cl2N5 — CID 145099381
N-[2-(1-benzyl-7-chloroindol-3-yl)-8-chloroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 145099381) has the molecular formula C28H27Cl2N5 and a molecular weight of 504.47 g/mol. Its IUPAC name is N-[2-(1-benzyl-7-chloroindol-3-yl)-8-chloroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(1-benzyl-7-chloroindol-3-yl)-8-chloroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145099381 |
| Molecular Formula | C28H27Cl2N5 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[2-(1-benzyl-7-chloroindol-3-yl)-8-chloroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2cn(Cc3ccccc3)c3c(Cl)cccc23)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C28H27Cl2N5/c1-34(2)16-8-15-31-27-21-12-7-13-23(29)25(21)32-28(33-27)22-18-35(17-19-9-4-3-5-10-19)26-20(22)11-6-14-24(26)30/h3-7,9-14,18H,8,15-17H2,1-2H3,(H,31,32,33) |
| InChIKey | DLTQYHTZJHVLNF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|