C53H44N6O — CID 162216990
N',N'-dimethyl-N-(2-naphthalen-2-yl-8-phenylquinazolin-4-yl)propane-1,3-diamine;2-naphthalen-2-yl-8-phenyl-3H-quinazolin-4-one (PubChem CID 162216990) has the molecular formula C53H44N6O and a molecular weight of 780.98 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-naphthalen-2-yl-8-phenylquinazolin-4-yl)propane-1,3-diamine;2-naphthalen-2-yl-8-phenyl-3H-quinazolin-4-one.
| Compound Name | N',N'-dimethyl-N-(2-naphthalen-2-yl-8-phenylquinazolin-4-yl)propane-1,3-diamine;2-naphthalen-2-yl-8-phenyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 162216990 |
| Molecular Formula | C53H44N6O |
| Molecular Weight | 780.98 g/mol |
| Exact Mass | 780.36 |
| IUPAC Name | N',N'-dimethyl-N-(2-naphthalen-2-yl-8-phenylquinazolin-4-yl)propane-1,3-diamine;2-naphthalen-2-yl-8-phenyl-3H-quinazolin-4-one |
| SMILES | CN(C)CCCNc1nc(-c2ccc3ccccc3c2)nc2c(-c3ccccc3)cccc12.O=c1[nH]c(-c2ccc3ccccc3c2)nc2c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C29H28N4.C24H16N2O/c1-33(2)19-9-18-30-29-26-15-8-14-25(22-11-4-3-5-12-22)27(26)31-28(32-29)24-17-16-21-10-6-7-13-23(21)20-24;27-24-21-12-6-11-20(17-8-2-1-3-9-17)22(21)25-23(26-24)19-14-13-16-7-4-5-10-18(16)15-19/h3-8,10-17,20H,9,18-19H2,1-2H3,(H,30,31,32);1-15H,(H,25,26,27) |
| InChIKey | ZTPJFWOIIHTGEQ-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.98 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|