C24H18N2O — CID 145099401
2-[3,4-bis(ethenyl)phenyl]-8-phenyl-3H-quinazolin-4-one (PubChem CID 145099401) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[3,4-bis(ethenyl)phenyl]-8-phenyl-3H-quinazolin-4-one.
| Compound Name | 2-[3,4-bis(ethenyl)phenyl]-8-phenyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 145099401 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[3,4-bis(ethenyl)phenyl]-8-phenyl-3H-quinazolin-4-one |
| SMILES | C=Cc1ccc(-c2nc3c(-c4ccccc4)cccc3c(=O)[nH]2)cc1C=C |
| InChI | InChI=1S/C24H18N2O/c1-3-16-13-14-19(15-17(16)4-2)23-25-22-20(18-9-6-5-7-10-18)11-8-12-21(22)24(27)26-23/h3-15H,1-2H2,(H,25,26,27) |
| InChIKey | WLOWPEMCCXZLRH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |