C21H13N5O2 — CID 135869738
5,13-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9,13-pentaene-7,11-dione (PubChem CID 135869738) has the molecular formula C21H13N5O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 5,13-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9,13-pentaene-7,11-dione.
| Compound Name | 5,13-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9,13-pentaene-7,11-dione |
|---|---|
| PubChem CID | 135869738 |
| Molecular Formula | C21H13N5O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5,13-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9,13-pentaene-7,11-dione |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2nc3nc(-c4ccccc4)[nH]c(=O)c3cc12 |
| InChI | InChI=1S/C21H13N5O2/c27-20-14-11-15-19(23-17(26-21(15)28)13-9-5-2-6-10-13)24-18(14)22-16(25-20)12-7-3-1-4-8-12/h1-11H,(H2,22,23,24,25,26,27,28) |
| InChIKey | MODUNDUZUCZUJG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|