C24H26N4S — CID 166431287
N-(2,6-diphenylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 166431287) has the molecular formula C24H26N4S and a molecular weight of 402.57 g/mol. Its IUPAC name is N-(2,6-diphenylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(2,6-diphenylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 166431287 |
| Molecular Formula | C24H26N4S |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-(2,6-diphenylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNc1nc(-c2ccccc2)nc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C24H26N4S/c1-28(2)16-10-9-15-25-23-20-17-21(18-11-5-3-6-12-18)29-24(20)27-22(26-23)19-13-7-4-8-14-19/h3-8,11-14,17H,9-10,15-16H2,1-2H3,(H,25,26,27) |
| InChIKey | JZCJEHCJPVFZEB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|