C20H18N4OS — CID 26455462
N-(2-methoxyethyl)-6-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 26455462) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2-methoxyethyl)-6-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 26455462 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(2-methoxyethyl)-6-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCNc1nc(-c2cccnc2)nc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C20H18N4OS/c1-25-11-10-22-19-16-12-17(14-6-3-2-4-7-14)26-20(16)24-18(23-19)15-8-5-9-21-13-15/h2-9,12-13H,10-11H2,1H3,(H,22,23,24) |
| InChIKey | VFGKVGHNWRTPFV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|