C21H23F2N5 — CID 112880917
4-N-(2,6-difluorophenyl)-6-N-[3-(dimethylamino)propyl]-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880917) has the molecular formula C21H23F2N5 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-N-(2,6-difluorophenyl)-6-N-[3-(dimethylamino)propyl]-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,6-difluorophenyl)-6-N-[3-(dimethylamino)propyl]-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880917 |
| Molecular Formula | C21H23F2N5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 4-N-(2,6-difluorophenyl)-6-N-[3-(dimethylamino)propyl]-2-phenylpyrimidine-4,6-diamine |
| SMILES | CN(C)CCCNc1cc(Nc2c(F)cccc2F)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H23F2N5/c1-28(2)13-7-12-24-18-14-19(25-20-16(22)10-6-11-17(20)23)27-21(26-18)15-8-4-3-5-9-15/h3-6,8-11,14H,7,12-13H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | OMNNZXJQXPHZNK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|