C29H29Cl2N5 — CID 121402817
N-[2-(1-benzyl-6,7-dichloroindol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402817) has the molecular formula C29H29Cl2N5 and a molecular weight of 518.49 g/mol. Its IUPAC name is N-[2-(1-benzyl-6,7-dichloroindol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(1-benzyl-6,7-dichloroindol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402817 |
| Molecular Formula | C29H29Cl2N5 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[2-(1-benzyl-6,7-dichloroindol-3-yl)-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cccc2c(NCCCN(C)C)nc(-c3cn(Cc4ccccc4)c4c(Cl)c(Cl)ccc34)nc12 |
| InChI | InChI=1S/C29H29Cl2N5/c1-19-9-7-12-22-26(19)33-29(34-28(22)32-15-8-16-35(2)3)23-18-36(17-20-10-5-4-6-11-20)27-21(23)13-14-24(30)25(27)31/h4-7,9-14,18H,8,15-17H2,1-3H3,(H,32,33,34) |
| InChIKey | SYXYDDQPJSDTED-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|