C24H18ClN3O — CID 137108909
2-(1-benzyl-7-chloroindol-3-yl)-8-methyl-3H-quinazolin-4-one (PubChem CID 137108909) has the molecular formula C24H18ClN3O and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-(1-benzyl-7-chloroindol-3-yl)-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-(1-benzyl-7-chloroindol-3-yl)-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137108909 |
| Molecular Formula | C24H18ClN3O |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-(1-benzyl-7-chloroindol-3-yl)-8-methyl-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(-c3cn(Cc4ccccc4)c4c(Cl)cccc34)nc12 |
| InChI | InChI=1S/C24H18ClN3O/c1-15-7-5-11-18-21(15)26-23(27-24(18)29)19-14-28(13-16-8-3-2-4-9-16)22-17(19)10-6-12-20(22)25/h2-12,14H,13H2,1H3,(H,26,27,29) |
| InChIKey | DHEDPHYPYDJHIE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |