C10H10N2O2 — CID 135726664
2-(hydroxymethyl)-8-methyl-3H-quinazolin-4-one (PubChem CID 135726664) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(hydroxymethyl)-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-(hydroxymethyl)-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135726664 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-(hydroxymethyl)-8-methyl-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CO)nc12 |
| InChI | InChI=1S/C10H10N2O2/c1-6-3-2-4-7-9(6)11-8(5-13)12-10(7)14/h2-4,13H,5H2,1H3,(H,11,12,14) |
| InChIKey | CSRHBZHXJMTRDD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |