C19H20N2O — CID 145099400
2-[2-(3,4-dimethylphenyl)ethyl]-8-methyl-3H-quinazolin-4-one (PubChem CID 145099400) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)ethyl]-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[2-(3,4-dimethylphenyl)ethyl]-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 145099400 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)ethyl]-8-methyl-3H-quinazolin-4-one |
| SMILES | Cc1ccc(CCc2nc3c(C)cccc3c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C19H20N2O/c1-12-7-8-15(11-14(12)3)9-10-17-20-18-13(2)5-4-6-16(18)19(22)21-17/h4-8,11H,9-10H2,1-3H3,(H,20,21,22) |
| InChIKey | WKALZIYXKAOPSN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |