C15H13N3O2S — CID 135739677
8-methyl-2-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135739677) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 8-methyl-2-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 8-methyl-2-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135739677 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 8-methyl-2-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CSc3cccc[n+]3[O-])nc12 |
| InChI | InChI=1S/C15H13N3O2S/c1-10-5-4-6-11-14(10)16-12(17-15(11)19)9-21-13-7-2-3-8-18(13)20/h2-8H,9H2,1H3,(H,16,17,19) |
| InChIKey | GCIKFVYUPZADLC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|